Home
Products
Licoflavonol
| Product Name | Licoflavonol |
| Price: | $584 / 5mg |
| Catalog No.: | CN04720 |
| CAS No.: | 60197-60-6 |
| Molecular Formula: | C20H18O6 |
| Molecular Weight: | 354.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)cc2c(c1O)c(=O)c(c(o2)c1ccc(cc1)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licoflavonol, a minor flavone from the roots of Glycyrrhiza uralensis, is an inhibitor of the Salmonella type III secretion system (T3SS)[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 608.3±55.0 °C at 760 mmHg |
| Flash Point | 220.2±25.0 °C |
| Exact Mass | 354.110352 |
| PSA | 111.13000 |
| LogP | 4.15 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |