Home
Products
Glabrone
| Product Name | Glabrone |
| Price: | $307 / 5mg |
| Catalog No.: | CN04526 |
| CAS No.: | 60008-02-8 |
| Molecular Formula: | C20H16O5 |
| Molecular Weight: | 336.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cudrania tricuspidata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)occ(c2=O)c1ccc2c(c1O)C=CC(O2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glabrone is an isoflavone isolated from Glycyrrhiza glabra roots. Glabrone exhibits anti-influenza activity and significant PPAR-γ ligand-binding activity[1][2]. |
| Target | PPAR-γ |
| Density | 1.368g/cm3 |
| Boiling Point | 554.1ºC at 760 mmHg |
| Flash Point | 202.6ºC |
| Exact Mass | 336.10000 |
| PSA | 79.90000 |
| LogP | 4.05540 |