Home
Products
Adenosine cyclophosphate
| Product Name | Adenosine cyclophosphate |
| Price: | $15 / 20mg |
| Catalog No.: | CN01992 |
| CAS No.: | 60-92-4 |
| Molecular Formula: | C10H12N5O6P |
| Molecular Weight: | 329.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H]2OP(=O)(O)OC[C@H]2O[C@H]1n1cnc2c1ncnc2N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | cAMP is a mitogenic messenger and promotes the G1 to S phase transition in the cell cycle. |
| Target | Human Endogenous Metabolite |
| Density | 2.5±0.1 g/cm3 |
| Boiling Point | 701.5±70.0 °C at 760 mmHg |
| Flash Point | 378.0±35.7 °C |
| Exact Mass | 329.052521 |
| PSA | 164.65000 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |