Home
Products
3',4'-dihydro-3'-hydroxy-Xanthyletin
| Product Name | 3',4'-dihydro-3'-hydroxy-Xanthyletin |
| Price: | $146 / 10mg |
| Catalog No.: | CN06161 |
| CAS No.: | 5993-18-0 |
| Molecular Formula: | C14H14O4 |
| Molecular Weight: | 246.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica gigas |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)cc1c(c2)CC(C(O1)(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (±)-Decursinol is a potent FtsZ inhibitor. (±)-Decursinol inhibits B. anthracis FtsZ polymerization with an IC50 of 102 μM[1]. |
| Exact Mass | 246.08900 |
| PSA | 59.67000 |
| LogP | 1.86740 |