Home
Products
Loliolid
| Product Name | Loliolid |
| Price: | Inquiry |
| Catalog No.: | CN09650 |
| CAS No.: | 5989-02-6 |
| Molecular Formula: | C11H16O3 |
| Molecular Weight: | 196.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Eucommia ulmoides Oliver |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@@]2(C)OC(=O)C=C2C(C1)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Loliolide, a Carotenoid Metabolite, is a potential endogenous inducer of herbivore resistance. Loliolide also inhibits the seedling growth. |
| Density | 1.16±0.1 g/cm3(Predicted) |
| Boiling Point | 352.7±42.0 °C(Predicted) |
| Exact Mass | 196.11000 |
| PSA | 46.53000 |
| LogP | 1.40920 |