Home
Products
Glabrol
| Product Name | Glabrol |
| Price: | $409 / 10mg |
| Catalog No.: | CN04525 |
| CAS No.: | 59870-65-4 |
| Molecular Formula: | C25H28O4 |
| Molecular Weight: | 392.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1cc(ccc1O)C1CC(=O)c2c(O1)c(CC=C(C)C)c(cc2)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glabrol (Compound 1), One isoprenyl flavonoid was isolated from ethanol extract of licorice roots, is a potent and non-competitive Acyl-coenzyme A: cholesterol acyltransferase (ACAT) inhibitor with an IC50 value of 24.6 μM for rat liver microsomal ACAT activity[1]. |
| Target | ratACAT:24.6 μM (IC50) |
| In Vitro | Glabrol (Compound 1) decreases cholesteryl ester formation with an IC50 value of 26.0 μM in HepG2 cells[1]. |
| Density | 1.166g/cm3 |
| Boiling Point | 600ºC at 760 mmHg |
| Flash Point | 204.3ºC |
| Exact Mass | 392.19900 |
| PSA | 66.76000 |
| LogP | 5.82170 |