Home
Products
Isopropyl ferulate
| Product Name | Isopropyl ferulate |
| Price: | $234 / 20mg |
| Catalog No.: | CN06795 |
| CAS No.: | 59831-94-6 |
| Molecular Formula: | C13H16O4 |
| Molecular Weight: | 236.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ligusticum chuanxiong Hort. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C(=O)OC(C)C)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isopropyl ferulate, isolated from Rhizoma et Radix Notopterygii (Qianghuo), is used in the reduction of pharmaceuticals, preparation of antifungal agents, cosmetics and as antioxidant agent and so forth[1]. |
| Density | 1.145g/cm3 |
| Boiling Point | 358.2ºC at 760mmHg |
| Flash Point | 131.9ºC |
| Exact Mass | 236.10500 |
| PSA | 55.76000 |
| LogP | 2.36560 |