Home
Products
Piperlonguminine
| Product Name | Piperlonguminine |
| Price: | Inquiry |
| Catalog No.: | CN00717 |
| CAS No.: | 5950-12-9 |
| Molecular Formula: | C16H19NO3 |
| Molecular Weight: | 273.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Piper nigrum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CNC(=O)/C=C/C=C/c1ccc2c(c1)OCO2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Piperlonguminine is an alkaloid amide isolated from the Piper species. Piperlonguminine shows various biological properties, including anti-inflammatory, antitumor, neuroprotective, anti-platelet, anti-melanogenic, antifungal and antibacterial activities[1][2][3][4]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 476.9±45.0 °C at 760 mmHg |
| Flash Point | 242.2±28.7 °C |
| Exact Mass | 273.136505 |
| PSA | 47.56000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8℃ |