Home
Products
Cinchonine hydrochloride
| Product Name | Cinchonine hydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN00743 |
| CAS No.: | 5949-11-1 |
| Molecular Formula: | C19H23ClN2O |
| Molecular Weight: | 330.85 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Cinchona ledgeriana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](c1ccnc2c1cccc2)O.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cinchonine hydrochloride ((8R,9S)-Cinchonine hydrochloride) is a natural compound present in Cinchona bark. Cinchonine hydrochloride activates endoplasmic reticulum stress-induced apoptosis in human liver cancer cells[1]. |
| Boiling Point | 464.5ºC at 760 mmHg |
| Exact Mass | 330.149902 |
| PSA | 36.36000 |
| LogP | 3.90450 |