Home
Products
1,1,1-Kestopentaose
| Product Name | 1,1,1-Kestopentaose |
| Price: | $103 / 10mg |
| Catalog No.: | CN06497 |
| CAS No.: | 59432-60-9 |
| Molecular Formula: | C30H52O26 |
| Molecular Weight: | 828.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Hordeum vulgare L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@]([C@H]([C@@H]1O)O)(CO[C@]1(CO[C@]2(CO)O[C@@H]([C@H]([C@@H]2O)O)CO)O[C@@H]([C@H]([C@@H]1O)O)CO)OC[C@@]1(O[C@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O[C@@H]([C@H]([C@@H]1O)O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1F-Fructofuranosylnystose can be used in the synthesis of Fructooligosaccharides (FOSs). Fructooligosaccharides exhibit lots of beneficial effects on our health and have been used as food ingredients. |
| In Vitro | Fructooligosaccharides (FOSs), as a mixture of 1-kestose, nystose, and 1F-fructofuranosylnystose oligosaccharides, exhibit lots of beneficial effects on our health and have been used as food ingredients[1]. |
| Exact Mass | 828.27500 |
| PSA | 426.98000 |
| Storage condition | 2-8C |