Home
Products
6-Hydroxytropinone
| Product Name | 6-Hydroxytropinone |
| Price: | Inquiry |
| Catalog No.: | CN00621 |
| CAS No.: | 5932-53-6 |
| Molecular Formula: | C8H13NO2 |
| Molecular Weight: | 155.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Atropa belladonna |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C[C@H]2C[C@@H]([C@@H](C1)N2C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 291.6±35.0 °C at 760 mmHg |
| Flash Point | 130.1±25.9 °C |
| Exact Mass | 155.094635 |
| PSA | 40.54000 |
| LogP | -1.00 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |