Home
Products
Lindleyin
| Product Name | Lindleyin |
| Price: | $336 / 5mg |
| Catalog No.: | CN03459 |
| CAS No.: | 59282-56-3 |
| Molecular Formula: | C23H26O11 |
| Molecular Weight: | 478.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Rheum palmatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC(=O)CCc1ccc(cc1)O[C@@H]1O[C@H](COC(=O)c2cc(O)c(c(c2)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lindleyin, isolated from Rhei rhizoma, mediates hormonal effects through estrogen receptors. Lindleyin binds to ERα with estrogenic activity[1]. |
| Density | 1.497g/cm3 |
| Boiling Point | 785.4ºC at 760 mmHg |
| Flash Point | 270.1ºC |
| Exact Mass | 478.14800 |
| PSA | 183.21000 |
| LogP | 0.36840 |
| Storage condition | 2-8℃ |