Home
Products
Sissotrin
| Product Name | Sissotrin |
| Price: | Inquiry |
| Catalog No.: | CN05289 |
| CAS No.: | 5928-26-7 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Trifolium pratense L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(O)c3c(c2)occ(c3=O)c2ccc(cc2)OC)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 754.9±60.0 °C at 760 mmHg |
| Flash Point | 265.5±26.4 °C |
| Exact Mass | 446.121307 |
| PSA | 159.05000 |
| LogP | 0.97 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |