Home
Products
Folic acid
| Product Name | Folic acid |
| Price: | $15 / 20mg |
| Catalog No.: | CN02043 |
| CAS No.: | 59-30-3 |
| Molecular Formula: | C19H19N7O6 |
| Molecular Weight: | 441.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Mangifera indica L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)CC[C@@H](C(=O)O)NC(=O)c1ccc(cc1)NCc1cnc2c(n1)c(=O)[nH]c(n2)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Folic acid(Vitamin M; Vitamin B9) is a B vitamin; is necessary for the production and maintenance of new cells, for DNA synthesis and RNA synthesis. |
| Density | 1.6±0.1 g/cm3 |
| Exact Mass | 441.139679 |
| PSA | 213.28000 |
| LogP | -2.48 |
| Storage condition | 2~8°C |