Home
Products
Arjungenin
| Product Name | Arjungenin |
| Price: | Inquiry |
| Catalog No.: | CN07306 |
| CAS No.: | 58880-25-4 |
| Molecular Formula: | C30H48O6 |
| Molecular Weight: | 504.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rudgea viburnioides |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@]1(C)[C@@H](O)[C@H](O)C[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@H](O)C(CC1)(C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Arjungenin, a triterpene isolated from Terminalia arjuna, is an insect feeding-deterrent and growth inhibitor[1][2]. |
| Density | 1.23 |
| Exact Mass | 504.34500 |
| PSA | 118.22000 |
| LogP | 4.14760 |