Home
Products
Secoxyloganin
| Product Name | Secoxyloganin |
| Price: | $131 / 20mg |
| Catalog No.: | CN03139 |
| CAS No.: | 58822-47-2 |
| Molecular Formula: | C17H24O11 |
| Molecular Weight: | 404.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Solid |
| Source: | The vines of Lonicera japonica |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C=C[C@H]1[C@@H](OC=C([C@H]1CC(=O)O)C(=O)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Secoxyloganin, isolated from Lonicera japonica Thunb, inhibits the blood flow (BF) decrease. Secoxyloganin has allergy-preventive activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 649.5±55.0 °C at 760 mmHg |
| Flash Point | 231.8±25.0 °C |
| Exact Mass | 404.131866 |
| PSA | 172.21000 |
| LogP | -2.02 |
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |
| Storage condition | -20℃ |