Home
Products
Haplopine
| Product Name | Haplopine |
| Price: | $526 / 5mg |
| Catalog No.: | CN01128 |
| CAS No.: | 5876-17-5 |
| Molecular Formula: | C13H11NO4 |
| Molecular Weight: | 245.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Zanthoxylum bungeanum Maxim |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)ccc2c1nc1occc1c2OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Haplopine possesses photo-activated antimicrobial and DNA binding activities[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 431.2±40.0 °C at 760 mmHg |
| Flash Point | 214.6±27.3 °C |
| Exact Mass | 245.068802 |
| PSA | 64.72000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8°C |