Home
Products
Meranzin hydrate
| Product Name | Meranzin hydrate |
| Price: | $293 / 10mg |
| Catalog No.: | CN06240 |
| CAS No.: | 5875-49-0 |
| Molecular Formula: | C15H18O5 |
| Molecular Weight: | 278.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica biserrata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1C[C@@H](C(O)(C)C)O)oc(=O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Meranzin hydrate, an absorbed bioactive compound from the Traditional Chinese Medicine (TCM) Chaihu-Shugan-San (CSS), possess anti-depression and anti-atherosclerosis effects[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 500.5±50.0 °C at 760 mmHg |
| Flash Point | 188.3±23.6 °C |
| Exact Mass | 278.115417 |
| PSA | 79.90000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | ?20°C |