Home
Products
Licochalcone B
| Product Name | Licochalcone B |
| Price: | $204 / 10mg |
| Catalog No.: | CN05700 |
| CAS No.: | 58749-23-8 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza glabra L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(C=CC(=O)c2ccc(cc2)O)ccc(c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licochalcone B is an extract from the root of Glycyrrhiza inflate. Licochalcone B inhibits amyloid β (Aβ42) self-aggregation (IC50=2.16 μM) and disaggregate pre-formed Aβ42 fibrils, reduce metal-induced Aβ42 aggregation through chelating metal ions[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 550.5±50.0 °C at 760 mmHg |
| Flash Point | 208.5±23.6 °C |
| Exact Mass | 286.084137 |
| PSA | 86.99000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8C |