Home
Products
Licochalcone A
| Product Name | Licochalcone A |
| Price: | $46 / 20mg |
| Catalog No.: | CN05701 |
| CAS No.: | 58749-22-7 |
| Molecular Formula: | C21H22O4 |
| Molecular Weight: | 338.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Glycyrrhiza glabra L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CC(c1cc(/C=C/C(=O)c2ccc(cc2)O)c(cc1O)OC)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licochalcone A, a flavonoid isolated from the famous Chinese medicinal herb Glycyrrhiza uralensis Fisch, presents obvious anti-cancer effects. The IC50 value is 0.97 μM for UGT1A1. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 532.6±50.0 °C at 760 mmHg |
| Flash Point | 186.9±23.6 °C |
| Exact Mass | 338.151794 |
| PSA | 66.76000 |
| LogP | 4.95 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | ?20°C |