Home
Products
Dihydrokavain
| Product Name | Dihydrokavain |
| Price: | $321 / 10mg |
| Catalog No.: | CN03862 |
| CAS No.: | 587-63-3 |
| Molecular Formula: | C14H16O3 |
| Molecular Weight: | 232.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Piper methysticum Forst. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC1=CC(=O)O[C@H](C1)CCc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydrokavain is one of the six major kavalactones found in the kava plant; appears to contribute significantly to the anxiolytic effects of kava, based on a study in chicks. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 413.6±45.0 °C at 760 mmHg |
| Flash Point | 175.6±23.3 °C |
| Exact Mass | 232.109940 |
| PSA | 35.53000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Storage condition | -20℃ |