Home
Products
Saikosaponin B4
| Product Name | Saikosaponin B4 |
| Price: | $234 / 10mg |
| Catalog No.: | CN07262 |
| CAS No.: | 58558-09-1 |
| Molecular Formula: | C43H72O14 |
| Molecular Weight: | 813.03 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Bupleurum chinense DC. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CO[C@@H]1C=C2[C@@H]3CC(C)(C)CC[C@]3(CO)[C@@H](C[C@]2([C@]2([C@H]1[C@@]1(C)CC[C@@H]([C@@]([C@@H]1CC2)(C)CO)O[C@@H]1O[C@H](C)[C@@H]([C@@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Saikosaponin B4 is a member of saikosaponins isolated from the roots of B. falcatum, selectively inhibits ACTH-induced lipolysis[1]. |