Home
Products
Schisantherin B
| Product Name | Schisantherin B |
| Price: | $146 / 20mg |
| Catalog No.: | CN02967 |
| CAS No.: | 58546-55-7 |
| Molecular Formula: | C28H34O9 |
| Molecular Weight: | 514.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | White powder |
| Source: | The seeds of Schisandra chinensis (Turcz.) Baill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)O[C@H]1c2cc(OC)c(c(c2[C@@H]2C(=C[C@@H]([C@]1(C)O)C)C=C1C(=C2OC)OCO1)OC)OC)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Schisantherin B is a natural product. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 675.0±55.0 °C at 760 mmHg |
| Flash Point | 220.3±25.0 °C |
| Exact Mass | 514.220276 |
| PSA | 101.91000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |