Home
Products
Gomisin A
| Product Name | Gomisin A |
| Price: | Inquiry |
| Catalog No.: | CN02929 |
| CAS No.: | 58546-54-6 |
| Molecular Formula: | C23H28O7 |
| Molecular Weight: | 416.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schizandra chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CC(C)(O)C(C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Schisandrol B is one of its major active constituents of traditional hepato-protective Chinese medicine, Schisandra sphenanthera.IC50 value:Target:in vitro: SolB pretreatment significantly attenuated the increases in alanine aminotransferase and aspartate aminotransferase activity, and prevented elevated hepatic malondialdehyde formation and the depletion of mitochondrial glutathione (GSH) in a dose-dependent manner. SolB also dramatically altered APAP metabolic activation by inhibiting the activities of CYP2E1 and CYP3A11, which was evidenced by significant inhibition of the formation of the oxidized APAP metabolite NAPQI-GSH [1]. SolB abrogated APAP-induced activation of p53 and p21, and increased expression of liver regeneration and antiapoptotic-related proteins such as cyclin D1 (CCND1), PCNA, and BCL-2. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 579.7±50.0 °C at 760 mmHg |
| Flash Point | 304.4±30.1 °C |
| Exact Mass | 416.183502 |
| PSA | 75.61000 |
| LogP | 4.77 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |