Home
Products
Rebaudioside B
| Product Name | Rebaudioside B |
| Price: | $204 / 10mg |
| Catalog No.: | CN08656 |
| CAS No.: | 58543-17-2 |
| Molecular Formula: | C38H60O18 |
| Molecular Weight: | 804.87 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Stevia rebaudiana Bertoni. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@]23CC[C@@H]4[C@@](C2)(CC3=C)CC[C@H]2[C@@]4(C)CCC[C@@]2(C)C(=O)O)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rebaudioside B is the minor constituent isolated from the leaves of Stevia rebaudiana Bertoni. Rebaudioside B tastes about 150 times sweeter than sucrose [1]. |
| Density | 1.53g/cm3 |
| Boiling Point | 1000.6ºC at 760mmHg |
| Flash Point | 302.5ºC |
| Exact Mass | 804.37800 |
| PSA | 294.98000 |