Home
Products
cis-Aconitic acid
| Product Name | cis-Aconitic acid |
| Price: | Inquiry |
| Catalog No.: | CN06428 |
| CAS No.: | 585-84-2 |
| Molecular Formula: | C6H6O6 |
| Molecular Weight: | 174.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The leaves of Echinodorus grandiflorus. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C/C(=C/C(=O)O)/C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (Z)-Aconitic acid (cis-Aconitic acid) is the cis-isomer of Aconitic acid. (Z)-Aconitic acid (cis-Aconitic acid) is an intermediate in the tricarboxylic acid cycle produced by the dehydration of citric acid. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 542.6±50.0 °C at 760 mmHg |
| Flash Point | 296.0±26.6 °C |
| Exact Mass | 174.016434 |
| PSA | 111.90000 |
| LogP | 0.63 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | 2-8°C |