Home
Products
Dihydroresveratrol
| Product Name | Dihydroresveratrol |
| Price: | $62 / 10mg |
| Catalog No.: | CN04007 |
| CAS No.: | 58436-28-5 |
| Molecular Formula: | C14H14O3 |
| Molecular Weight: | 230.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Dioscorea bulbifera |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)CCc1cc(O)cc(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydroresveratrol, a potent phytoestrogen, is a hormone receptor modulator. Dihydroresveratrol exhibits proliferative effects in androgen-independent prostate and breast cancer cells at picomolar and nanomolar concentrations[1]. |
| In Vitro | Treatment with 0.1 nM-0.1 μM of Dihydroresveratrol significantly increases the growth of PC-3 prostate cancer cells[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 430.3±14.0 °C at 760 mmHg |
| Flash Point | 210.9±14.7 °C |
| Exact Mass | 230.094299 |
| PSA | 60.69000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |