Home
Products
Isopimaric acid
| Product Name | Isopimaric acid |
| Price: | $467 / 5mg |
| Catalog No.: | CN08707 |
| CAS No.: | 5835-26-7 |
| Molecular Formula: | C20H30O2 |
| Molecular Weight: | 302.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Daemonorops draco Blume |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CC1(C)CCC2C(=CCC3C2(C)CCCC3(C)C(=O)O)C1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isopimaric acid is a potent opener of large conductance calcium activated K+ (BK) channels. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 416.7±45.0 °C at 760 mmHg |
| Flash Point | 200.0±23.4 °C |
| Exact Mass | 302.224579 |
| PSA | 37.30000 |
| LogP | 6.61 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |