Home
Products
Kakkalide
| Product Name | Kakkalide |
| Price: | $409 / 10mg |
| Catalog No.: | CN04537 |
| CAS No.: | 58274-56-9 |
| Molecular Formula: | C28H32O15 |
| Molecular Weight: | 608.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1c(O[C@@H]2O[C@H](CO[C@@H]3OC[C@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O)O)O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kakkalide is an isoflavone derived from the flowers of Pueraria lobata. Kakkalide ameliorates endothelial insulin resistance by suppressing reactive oxygen species (ROS)-associated inflammation[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 902.0±65.0 °C at 760 mmHg |
| Flash Point | 296.9±27.8 °C |
| Exact Mass | 608.174133 |
| PSA | 227.20000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |