Home
Products
Suberosin
| Product Name | Suberosin |
| Price: | $109 / 10mg |
| Catalog No.: | CN06241 |
| CAS No.: | 581-31-7 |
| Molecular Formula: | C15H16O3 |
| Molecular Weight: | 244.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica pubescens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(=O)ccc2cc1CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Suberosin, isolated from Plumbago zeylanica, exhibits anti-inflammatory and anticoagulant activity. Suberosin suppresses PHA-induced PBMC proliferation and arrested cell cycle progression from the G1 transition to the S phase through the modulation of the transcription factors NF-AT and NF-κB[1][2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 393.3±42.0 °C at 760 mmHg |
| Flash Point | 166.0±22.5 °C |
| Exact Mass | 244.109940 |
| PSA | 39.44000 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |