Home
Products
Matairesinol
| Product Name | Matairesinol |
| Price: | $351 / 5mg |
| Catalog No.: | CN02930 |
| CAS No.: | 580-72-3 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The roots of Wikstroemia indica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)C[C@H]1C(=O)OC[C@@H]1Cc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Matairesinol confers anti-allergic effects in an allergic dermatitis mouse model. DfE-induced changes in IL-4 and IFN-γ mRNA expression in the ears of NC/Nga mice were reversed by matairesinol application[1]. |
| Target | Human Endogenous Metabolite |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 593.0±45.0 °C at 760 mmHg |
| Flash Point | 212.3±22.2 °C |
| Exact Mass | 358.141632 |
| PSA | 85.22000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8°C |