Home
Products
Uridine
| Product Name | Uridine |
| Price: | $15 / 20mg |
| Catalog No.: | CN01729 |
| CAS No.: | 58-96-8 |
| Molecular Formula: | C9H12N2O6 |
| Molecular Weight: | 244.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Heracleum stenopterum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1ccc(=O)[nH]c1=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Uridin is a glycosylated pyrimidine-analog containing uracil attached to a ribose ring (or more specifically, aribofuranose) via a β-N1-glycosidic bond. |
| Target | Human Endogenous Metabolite |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 567.9±60.0 °C at 760 mmHg |
| Flash Point | 297.2±32.9 °C |
| Exact Mass | 244.069534 |
| PSA | 124.78000 |
| LogP | -1.55 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Storage condition | 2~8°C |