Home
Products
alpha-Tocopherol acetate
| Product Name | alpha-Tocopherol acetate |
| Price: | Inquiry |
| Catalog No.: | CN04004 |
| CAS No.: | 58-95-7 |
| Molecular Formula: | C31H52O3 |
| Molecular Weight: | 472.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The herbs of Isodon adenantha |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H](CCC[C@]1(C)CCc2c(O1)c(C)c(c(c2C)OC(=O)C)C)CCC[C@@H](CCCC(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-α-Tocopherol acetate (D-Vitamin E acetate) can be hydrolyzed to d-alpha-tocopherol (VE) and absorbed in the small intestine[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 184 ºC |
| Flash Point | 235.6±24.7 °C |
| Exact Mass | 472.391632 |
| PSA | 35.53000 |
| LogP | 12.07 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |