Home
Products
D-(+)-Xylose
| Product Name | D-(+)-Xylose |
| Price: | $11 / 20mg |
| Catalog No.: | CN06707 |
| CAS No.: | 58-86-6 |
| Molecular Formula: | C5H10O5 |
| Molecular Weight: | 150.13 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1COC(C([C@@H]1O)O)O C5H10O5 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Xylose, a natural product, can be catalyzed into xylulose by xylose isomerase, and it is the key step for anaerobic ethanolic fermentation of xylose. |
| Target | Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 415.5±38.0 °C at 760 mmHg |
| Flash Point | 219.2±23.3 °C |
| Exact Mass | 150.052826 |
| PSA | 90.15000 |
| LogP | -2.39 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |