Home
Products
Officinalisinin I
| Product Name | Officinalisinin I |
| Price: | $141 / 10mg |
| Catalog No.: | CN02427 |
| CAS No.: | 57944-18-0 |
| Molecular Formula: | C45H76O19 |
| Molecular Weight: | 921.07 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Anemarrhena asphodeloides Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@@](O2)(O)CCC(CO[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Officinalisinin I is a steroidal saponin, isolated from Anemarrhena asphodeloides. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 1033.6±65.0 °C at 760 mmHg |
| Flash Point | 578.9±34.3 °C |
| Exact Mass | 920.498108 |
| LogP | 0.34 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |