Home
Products
Corynoxidine
| Product Name | Corynoxidine |
| Price: | $321 / 10mg |
| Catalog No.: | CN00960 |
| CAS No.: | 57906-85-1 |
| Molecular Formula: | C21H25NO5 |
| Molecular Weight: | 371.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Stephania epigaea. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CC[N+]3(C(c2cc1OC)Cc1c(C3)c(OC)c(cc1)OC)[O-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Corynoxidine is an acetylcholinesterase inhibitor with an IC50 value of 89.0 μM, isolated from the aerial parts of Corydalis speciosa[1].(-)-Corynoxidine exhibits antibacterial activities against Staphylococcus aureus and methicillin-resistant S. aureus strains in different degrees[2]. |
| Target | IC50: 89.0 μM (acetylcholinesterase)[1] |
| Exact Mass | 371.17300 |
| PSA | 66.35000 |
| LogP | 3.34790 |