Home
Products
Equisetin
| Product Name | Equisetin |
| Price: | Inquiry |
| Catalog No.: | CN01832 |
| CAS No.: | 57749-43-6 |
| Molecular Formula: | C22H31NO4 |
| Molecular Weight: | 373.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From Fusarium equiseti |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C/[C@@H]1C=C[C@H]2[C@H]([C@]1(C)/C(=C1/C(=O)[C@@H](N(C1=O)C)CO)/O)CC[C@H](C2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Equisetin is an N-methylserine-derived acyl tetramic acid isolated from a terrestrial fungus Fusarium equiseti NRRL 5537[1]. Equisetin is a tetramate-containing natural product with antibiotic and cytotoxic activity[2]. Equisetin inhibits the growth of Gram-positive bacteria and HIV-1 integrase activity but shows no activity against Gram-negative bacteria[3]. Equisetin is a Quorum-sensing inhibitor (QSI) that attenuates QS-regulated virulence phenotypes in P. aeruginosa without affecting the growth of bacterias, serves as a leading compound for the treatment of P. aeruginosa infections[4]. |
| Density | 1.187 g/cm3 |
| Boiling Point | 513.6ºC at 760 mmHg |
| Flash Point | 264.4ºC |
| Exact Mass | 373.22500 |
| PSA | 77.84000 |
| LogP | 2.95920 |