Home
Products
Kansuinine A
| Product Name | Kansuinine A |
| Price: | $847 / 5mg |
| Catalog No.: | CN08560 |
| CAS No.: | 57701-86-7 |
| Molecular Formula: | C37H46O15 |
| Molecular Weight: | 730.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Euphorbia kansui |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1C(=C)C(OC(=O)C)C2C(OC(=O)C)C(CC2(OC(=O)C)C2(OC(C(C(C1OC(=O)c1ccccc1)OC(=O)C)(C)C)C(=O)C2C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kansuinine A inhibits IL-6-induced Stat3 activation. Kansuinine A possesses antiviral and anticancer activity[1][2]. |
| Exact Mass | 730.28400 |
| PSA | 204.33000 |
| LogP | 2.78530 |