Home
Products
Flavonol
| Product Name | Flavonol |
| Price: | $37 / 20mg |
| Catalog No.: | CN04383 |
| CAS No.: | 577-85-5 |
| Molecular Formula: | C15H10O3 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of blueberries. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1c(O)c(oc2c1cccc2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.367 g/cm3 |
| Boiling Point | 393.7ºC at 760 mmHg |
| Flash Point | 151.5ºC |
| Exact Mass | 238.06300 |
| PSA | 50.44000 |
| LogP | 3.16560 |
| Storage condition | 0-6°C |