Home
Products
Ayanin
| Product Name | Ayanin |
| Price: | $176 / 5mg |
| Catalog No.: | CN04864 |
| CAS No.: | 572-32-7 |
| Molecular Formula: | C18H16O7 |
| Molecular Weight: | 344.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma aromatica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ayanin is a bioflavonoid isolated from Croton schiedeanus Schlecht. Ayanin is a non-selective phosphodiesterase1-4 inhibitor and can be used for the study of respiratory disease,such as allergic asthma et al[1]. |
| Target | PDE2A PDE4 |
| In Vitro | Ayanin inhibits interleukin (IL)-4 production from purified basophils with an IC50 value of 2.2 μM[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 600.8±55.0 °C at 760 mmHg |
| Flash Point | 221.5±25.0 °C |
| Exact Mass | 344.089600 |
| PSA | 98.36000 |
| LogP | 2.43 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |