Home
Products
Engeletin
| Product Name | Engeletin |
| Price: | $92 / 20mg |
| Catalog No.: | CN05292 |
| CAS No.: | 572-31-6 |
| Molecular Formula: | C21H22O10 |
| Molecular Weight: | 434.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Engelhardtia roxburghiana Wall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)[C@H]1Oc2cc(O)cc(c2C(=O)[C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Engeletin is a flavanonol glycoside isolated from hymenaea martiana, inhibits NF-κB signaling-pathway activation, and possesses anti-inflammatory, analgesic, diuresis, detumescence, and antibiosis effects. |
| Target | NF-κB |
| In Vitro | Engeletin is a flavanonol glycoside isolated from hymenaea martiana, inhibits NF-κB signaling-pathway activation[1]. |
| In Vivo | Engeletin (25, 50, 100 mg/kg, i.p.) markedly reduces LPS-increased myeloperoxidase activity in mice, activates NF-κB-pathway activation, decreases the production of inflammatory mediators (iNOS and COX-2), and suppresses the expression of TLR4-signaling downstream molecules such as MyD88, IRAK1, TRAF6, and TAK1 proteins[1]. |
| Animal Admin | Mice[1] The mice are classified at random into the following six groups of 10 mice each to cause the endometritis model: blank group, LPS group, Engeletin (25, 50, and 100 mg/kg) + LPS groups, and Engeletin (100 mg/kg) group. Engeletin is solubilized by heated normal saline to give the final concentrations of 25, 50, and 100 mg/kg. Briefly, each uterus is infused with 50 μL of LPS (1 mg/mL) to induce endometritis. At 24 h after the instillation, Engeletin groups receive an intraperitoneal injection of diverse Engeletin concentrations (25, 50, and 100 mg/kg) three times (once every 6 h). The Engeletin group is given an intraperitoneal injection of Engeletin (100 mg/kg). The blank group receive the normal saline. Afterward, the mice are killed by CO2 inhalation. Uterus tissues are harvested and kept in −80°C[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 820.0±65.0 °C at 760 mmHg |
| Flash Point | 289.5±27.8 °C |
| PSA | 186.37000 |
| LogP | 0.25 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | 2~8℃ |