Home
Products
Cholesterol
| Product Name | Cholesterol |
| Price: | $15 / 20mg |
| Catalog No.: | CN02520 |
| CAS No.: | 57-88-5 |
| Molecular Formula: | C27H46O |
| Molecular Weight: | 386.67 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The leaves of Olea europaea L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC=C2[C@]1(C)CCC(C2)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cholesterol is the major sterol in mammals, and its importance in fundamental cellular processes is becoming more appreciated. IC50 value:Target:In vitro: GT1-7 hypothalamic cells subjected to cholesterol depletion in vitro produced 20-31% reductions in cellular cholesterol content, similar to the decrease in cholesterol synthesis observed in diabetes [1].In vivo: |
| Target | Human Endogenous Metabolite |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 360 ºC |
| Flash Point | 250 ºC |
| Exact Mass | 386.354858 |
| PSA | 20.23000 |
| LogP | 9.85 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |