Home
Products
Progesterone
| Product Name | Progesterone |
| Price: | $18 / 20mg |
| Catalog No.: | CN02521 |
| CAS No.: | 57-83-0 |
| Molecular Formula: | C21H30O2 |
| Molecular Weight: | 314.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1CC[C@]2(C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2C(=O)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Progesterone is a steroid hormone that regulates the menstrual cycle and is crucial for pregnancy. |
| Target | Human Endogenous Metabolite |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 447.2±45.0 °C at 760 mmHg |
| Flash Point | 166.7±25.7 °C |
| Exact Mass | 314.224579 |
| PSA | 34.14000 |
| LogP | 4.04 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |