Home
Products
Fructose
| Product Name | Fructose |
| Price: | $15 / 20mg |
| Catalog No.: | CN06697 |
| CAS No.: | 57-48-7 |
| Molecular Formula: | C6H12O6 |
| Molecular Weight: | 180.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | White cryst. |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]([C@H]([C@@H](C(=O)CO)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-Fructose (D(-)-Fructose) is a naturally occurring monosaccharide found in many plants. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 551.7±50.0 °C at 760 mmHg |
| Flash Point | 301.5±26.6 °C |
| Exact Mass | 180.063385 |
| PSA | 118.22000 |
| LogP | -1.63 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |