Home
Products
Vincristine
| Product Name | Vincristine |
| Price: | $92 / 20mg |
| Catalog No.: | CN01954 |
| CAS No.: | 57-22-7 |
| Molecular Formula: | C46H56N4O10 |
| Molecular Weight: | 824.96 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hedera nepalensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=CN1c2cc(OC)c(cc2[C@]23[C@@H]1[C@@](O)(C(=O)OC)[C@H](OC(=O)C)[C@]1([C@@H]3N(CC2)CC=C1)CC)[C@]1(C[C@H]2CN(CCc3c1[nH]c1c3cccc1)C[C@](C2)(O)CC)C(=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vincristine (Leurocristine) is a microtubule-destabilizing agent (MDA). Vincristine (Leurocristine) binds to tubulin and inhibits the formation of microtubules, thereby inhibiting mitosis of the cancer cell. Vincristine (Leurocristine) is used to treat hematologic cancers, such as leukemia and lymphoma, and childhood sarcomas[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Exact Mass | 824.399658 |
| PSA | 171.17000 |
| LogP | 2.82 |
| Storage condition | 2-8C |