Home
Products
Rhamnocitrin
| Product Name | Rhamnocitrin |
| Price: | $234 / 5mg |
| Catalog No.: | CN05190 |
| CAS No.: | 569-92-6 |
| Molecular Formula: | C16H12O6 |
| Molecular Weight: | 300.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The rhizomes of Alpinia officinarum Hance. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(c(c2=O)O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhamnocitrin is a flavonoid isolated from astragalus complanatus R. Br. (Sha-yuan-zi)[1]. Rhamnocitrin is a scavenger of DPPH with an IC50 of 28.38 mM. Rhamnocitrin has anti-oxidant, anti-inflammatory and an-tiatherosclerosis activity[2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 571.9±50.0 °C at 760 mmHg |
| Flash Point | 218.4±23.6 °C |
| Exact Mass | 300.063385 |
| PSA | 100.13000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |