Home
Products
Nepetin-7-glucoside
| Product Name | Nepetin-7-glucoside |
| Price: | $219 / 10mg |
| Catalog No.: | CN05167 |
| CAS No.: | 569-90-4 |
| Molecular Formula: | C22H22O12 |
| Molecular Weight: | 478.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Salvia plebeia R.Br. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3oc(cc(=O)c3c(c2OC)O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nepitrin, isolated from Scrophularia striata, possess significant anti-inflammatory and anti-arthritic activity[1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 844.7±65.0 °C at 760 mmHg |
| Flash Point | 294.9±27.8 °C |
| Exact Mass | 478.111115 |
| PSA | 199.51000 |
| LogP | -0.68 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Storage condition | 2-8℃ |