Home
Products
Erythrosin B
| Product Name | Erythrosin B |
| Price: | Inquiry |
| Catalog No.: | CN06360 |
| CAS No.: | 568-63-8 |
| Molecular Formula: | C20H6I4Na2O5 |
| Molecular Weight: | 879.86 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C1OC2(c3c1cccc3)c1cc(I)c(c(c1Oc1c2cc(I)c(c1I)O)I)O.[Na] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Acid Red 51 is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Boiling Point | 693.2ºC at 760 mmHg |
| Flash Point | 373ºC |
| Exact Mass | 879.618896 |
| PSA | 93.40000 |
| LogP | 5.49050 |