Home
Products
Icariside I
| Product Name | Icariside I |
| Price: | $131 / 20mg |
| Catalog No.: | CN05023 |
| CAS No.: | 56725-99-6 |
| Molecular Formula: | C27H30O11 |
| Molecular Weight: | 530.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Epimedium brevicornu. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2CC=C(C)C)oc(c(c3=O)O)c2ccc(cc2)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Icariside I is a metabolite of Icarlin, which could regulate bone remodeling and is recognized as an effective agent for the treatment of osteoporosis. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 801.3±65.0 °C at 760 mmHg |
| Flash Point | 267.8±27.8 °C |
| Exact Mass | 530.178833 |
| PSA | 179.28000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | 2-8C |