Home
Products
Batatasin III
| Product Name | Batatasin III |
| Price: | $277 / 5mg |
| Catalog No.: | CN03834 |
| CAS No.: | 56684-87-8 |
| Molecular Formula: | C15H16O3 |
| Molecular Weight: | 244.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Dendrobium venustum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(CCc2cccc(c2)O)cc(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Batatasin III, a stilbenoid, inhibits cancer migration and invasion by suppressing epithelial to mesenchymal transition (EMT) and FAK-AKT Signals. Batatasin III has anti-cancer activities[1]. |
| Target | Akt |
| In Vitro | Batatasin III (25-100 μM; 48 h) exhibits anti-proliferative activity in H460 cells. Batatasin III at concentrations lower than 100 μM has no cytotoxic effects[1]. Batatasin III significantly suppresses EMT indicated by the decrease of N-cadherin and Vimentin, and up-regulation of E-cadherin[1]. |
| Density | 1.126g/cm3 |
| Boiling Point | 406.1ºC at 760 mmHg |
| Flash Point | 199.4ºC |
| Exact Mass | 258.12600 |
| PSA | 38.69000 |
| LogP | 3.19460 |